C24H28N2O3 — CID 75768670
2-(4-benzylpiperidine-1-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one (PubChem CID 75768670) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(4-benzylpiperidine-1-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one.
| Compound Name | 2-(4-benzylpiperidine-1-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75768670 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-(4-benzylpiperidine-1-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)N1CCC(Cc3ccccc3)CC1)O2 |
| InChI | InChI=1S/C24H28N2O3/c1-17-9-10-21-20(15-17)25(3)22(27)24(2,29-21)23(28)26-13-11-19(12-14-26)16-18-7-5-4-6-8-18/h4-10,15,19H,11-14,16H2,1-3H3 |
| InChIKey | VXLSWFCOCICQRQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|