C11H8Cl2N2O2S — CID 7576962
(3,4-dichlorophenyl)methyl 4-methylthiadiazole-5-carboxylate (PubChem CID 7576962) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-methylthiadiazole-5-carboxylate.
| Compound Name | (3,4-dichlorophenyl)methyl 4-methylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 7576962 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-methylthiadiazole-5-carboxylate |
| SMILES | Cc1nnsc1C(=O)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N2O2S/c1-6-10(18-15-14-6)11(16)17-5-7-2-3-8(12)9(13)4-7/h2-4H,5H2,1H3 |
| InChIKey | YIYWWQLTPFMWFY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |