About Cambridge id 5425530
Cambridge id 5425530 (PubChem CID 757773) has the molecular formula C13H22N2S
and a molecular weight of 238.39 g/mol. Its IUPAC name is N,1-dimethyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | Cambridge id 5425530 |
| PubChem CID | 757773 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.39 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N,1-dimethyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine |
| SMILES | CC1=CC=C(S1)CN(C)C2CCN(CC2)C |
| InChI | InChI=1S/C13H22N2S/c1-11-4-5-13(16-11)10-15(3)12-6-8-14(2)9-7-12/h4-5,12H,6-10H2,1-3H3 |
| InChIKey | RPVACLUYJCXYEJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 214 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Cambridge id 5425530 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cambridge id 5425530?
The IUPAC name of Cambridge id 5425530 (CID 757773) is N,1-dimethyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine.
What is the SMILES notation for Cambridge id 5425530?
The canonical SMILES for Cambridge id 5425530 is CC1=CC=C(S1)CN(C)C2CCN(CC2)C.
What is the InChIKey of Cambridge id 5425530?
The InChIKey is RPVACLUYJCXYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2S/c1-11-4-5-13(16-11)10-15(3)12-6-8-14(2)9-7-12/h4-5,12H,6-10H2,1-3H3.
What are the key properties of Cambridge id 5425530?
Cambridge id 5425530 has a molecular weight of 238.39 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Cambridge id 5425530 is sourced from PubChem (CID 757773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).