C14H25NO4 — CID 7577914
ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 7577914) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 7577914 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-13(2,3)18-11(16)10-8-7-9-15(10)12(17)19-14(4,5)6/h10H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | UMCYLERMBHATJC-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |