About 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one
3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 757826) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| PubChem CID | 757826 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | Nn1cnc2c(c1=O)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H19N3O/c18-20-11-19-15-13-7-3-2-6-12(13)10-17(14(15)16(20)21)8-4-1-5-9-17/h2-3,6-7,11H,1,4-5,8-10,18H2 |
| InChIKey | ILSAONGGBDPOMC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one?
The IUPAC name of 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (CID 757826) is 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
What is the SMILES notation for 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one?
The canonical SMILES for 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one is Nn1cnc2c(c1=O)C1(CCCCC1)Cc1ccccc1-2.
What is the InChIKey of 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one?
The InChIKey is ILSAONGGBDPOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O/c18-20-11-19-15-13-7-3-2-6-12(13)10-17(14(15)16(20)21)8-4-1-5-9-17/h2-3,6-7,11H,1,4-5,8-10,18H2.
What are the key properties of 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one?
3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one has a molecular weight of 281.36 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one is sourced from PubChem (CID 757826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).