C18H17N3O7 — CID 7578310
N-(2-methoxy-5-nitrophenyl)-2-(4-nitro-2-prop-2-enylphenoxy)acetamide (PubChem CID 7578310) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-(4-nitro-2-prop-2-enylphenoxy)acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-(4-nitro-2-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 7578310 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-(4-nitro-2-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1cc([N+](=O)[O-])ccc1OCC(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C18H17N3O7/c1-3-4-12-9-13(20(23)24)5-7-16(12)28-11-18(22)19-15-10-14(21(25)26)6-8-17(15)27-2/h3,5-10H,1,4,11H2,2H3,(H,19,22) |
| InChIKey | IVCJNBSBTROMPR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|