C19H20N2O6 — CID 7579265
[2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7579265) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7579265 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1NC(=O)COC(=O)[C@H]1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C19H20N2O6/c1-25-16-7-3-2-6-15(16)20-17(22)12-27-19(24)13-9-18(23)21(10-13)11-14-5-4-8-26-14/h2-8,13H,9-12H2,1H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | AVAKEYIVCHGKAJ-ZDUSSCGKSA-N |
| XLogP | 1.82 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |