C18H21ClN2O3S2 — CID 7579313
N-[(3aS,6aR)-3-(2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclohexanecarboxamide (PubChem CID 7579313) has the molecular formula C18H21ClN2O3S2 and a molecular weight of 412.96 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclohexanecarboxamide.
| Compound Name | N-[(3aS,6aR)-3-(2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 7579313 |
| Molecular Formula | C18H21ClN2O3S2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[(3aS,6aR)-3-(2-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclohexanecarboxamide |
| SMILES | O=C(/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C18H21ClN2O3S2/c19-13-8-4-5-9-14(13)21-15-10-26(23,24)11-16(15)25-18(21)20-17(22)12-6-2-1-3-7-12/h4-5,8-9,12,15-16H,1-3,6-7,10-11H2/b20-18-/t15-,16-/m0/s1 |
| InChIKey | CQLOXAKHFMNZFR-VXAPJYQHSA-N |
| XLogP | 3.52 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|