C17H17N3O2S2 — CID 75797009
2-methyl-3-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75797009) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75797009 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-methyl-3-oxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC1(C(=O)Nc2nc3c(s2)CCCC3)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C17H17N3O2S2/c1-17(14(21)18-11-7-3-5-9-13(11)24-17)15(22)20-16-19-10-6-2-4-8-12(10)23-16/h3,5,7,9H,2,4,6,8H2,1H3,(H,18,21)(H,19,20,22) |
| InChIKey | NVLTXCPHZWONJG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|