C19H27N3O2S — CID 75797091
2-methyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75797091) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75797091 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-methyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)C2(C)Sc3ccccc3NC2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C19H27N3O2S/c1-17(2)10-12(11-18(3,4)22-17)20-15(23)19(5)16(24)21-13-8-6-7-9-14(13)25-19/h6-9,12,22H,10-11H2,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | GHGCWMZTPHDPQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|