C21H19N3O — CID 757999
N-(1,3-diphenylpropan-2-ylideneamino)pyridine-4-carboxamide (PubChem CID 757999) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(1,3-diphenylpropan-2-ylideneamino)pyridine-4-carboxamide.
| Compound Name | N-(1,3-diphenylpropan-2-ylideneamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 757999 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-(1,3-diphenylpropan-2-ylideneamino)pyridine-4-carboxamide |
| SMILES | O=C(NN=C(Cc1ccccc1)Cc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H19N3O/c25-21(19-11-13-22-14-12-19)24-23-20(15-17-7-3-1-4-8-17)16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H,24,25) |
| InChIKey | NCFANXGRONSQTN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|