About benzylbenzene
benzylbenzene (PubChem CID 7580) has the molecular formula C13H12
and a molecular weight of 168.24 g/mol. Its IUPAC name is benzylbenzene.
Molecular Properties
| Compound Name | benzylbenzene |
| PubChem CID | 7580 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | benzylbenzene |
| SMILES | c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | CZZYITDELCSZES-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene?
The IUPAC name of benzylbenzene (CID 7580) is benzylbenzene.
What is the SMILES notation for benzylbenzene?
The canonical SMILES for benzylbenzene is c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene?
The InChIKey is CZZYITDELCSZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of benzylbenzene?
benzylbenzene has a molecular weight of 168.24 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene is sourced from PubChem (CID 7580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).