C20H22N4O4 — CID 75801363
1-(furan-2-ylmethyl)-5-oxo-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrrolidine-3-carboxamide (PubChem CID 75801363) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-5-oxo-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-5-oxo-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75801363 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-5-oxo-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrrolidine-3-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)C2CC(=O)N(Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-2-9-21-20(27)23-16-7-5-15(6-8-16)22-19(26)14-11-18(25)24(12-14)13-17-4-3-10-28-17/h2-8,10,14H,1,9,11-13H2,(H,22,26)(H2,21,23,27) |
| InChIKey | YBFKPGLANABCFF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|