C18H25N3O — CID 75805432
5-[1-(4-benzylpiperidin-1-yl)ethyl]-3-ethyl-1,2,4-oxadiazole (PubChem CID 75805432) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 5-[1-(4-benzylpiperidin-1-yl)ethyl]-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-[1-(4-benzylpiperidin-1-yl)ethyl]-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75805432 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 5-[1-(4-benzylpiperidin-1-yl)ethyl]-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCc1noc(C(C)N2CCC(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H25N3O/c1-3-17-19-18(22-20-17)14(2)21-11-9-16(10-12-21)13-15-7-5-4-6-8-15/h4-8,14,16H,3,9-13H2,1-2H3 |
| InChIKey | KNDHGEREYSTIRJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |