C18H19F2NO2 — CID 75807721
N-ethyl-2,4-difluoro-N-[1-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 75807721) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is N-ethyl-2,4-difluoro-N-[1-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | N-ethyl-2,4-difluoro-N-[1-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 75807721 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-ethyl-2,4-difluoro-N-[1-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | CCN(C(=O)c1ccc(F)cc1F)C(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H19F2NO2/c1-4-21(12(2)13-6-5-7-15(10-13)23-3)18(22)16-9-8-14(19)11-17(16)20/h5-12H,4H2,1-3H3 |
| InChIKey | JRHKFMOHIXOYNF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |