C15H19N3O4 — CID 7581904
(2S)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-propylpropanamide (PubChem CID 7581904) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-propylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 7581904 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N3O4/c1-3-9-16-15(20)11(2)17-14(19)8-7-12-5-4-6-13(10-12)18(21)22/h4-8,10-11H,3,9H2,1-2H3,(H,16,20)(H,17,19)/b8-7+/t11-/m0/s1 |
| InChIKey | CDRAKZKSBOEREF-AEZGRPFRSA-N |
| XLogP | 1.64 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|