C24H31N3O2S — CID 7582219
(2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide (PubChem CID 7582219) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 7582219 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide |
| SMILES | C[C@@H](Sc1nc2ccccc2c(=O)n1CCC1=CCCCC1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H31N3O2S/c1-17(22(28)25-19-11-5-6-12-19)30-24-26-21-14-8-7-13-20(21)23(29)27(24)16-15-18-9-3-2-4-10-18/h7-9,13-14,17,19H,2-6,10-12,15-16H2,1H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | VHGZGOHNSKETCK-QGZVFWFLSA-N |
| XLogP | 4.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|