About phenoxybenzene
phenoxybenzene (PubChem CID 7583) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is phenoxybenzene.
Molecular Properties
| Compound Name | phenoxybenzene |
| PubChem CID | 7583 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | phenoxybenzene |
| SMILES | c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxybenzene?
The IUPAC name of phenoxybenzene (CID 7583) is phenoxybenzene.
What is the SMILES notation for phenoxybenzene?
The canonical SMILES for phenoxybenzene is c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of phenoxybenzene?
The InChIKey is USIUVYZYUHIAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenoxybenzene?
phenoxybenzene has a molecular weight of 170.21 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxybenzene is sourced from PubChem (CID 7583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).