C11H11NO2 — CID 75837145
4-hydroxy-5,7-dimethyl-4aH-quinolin-2-one (PubChem CID 75837145) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-hydroxy-5,7-dimethyl-4aH-quinolin-2-one.
| Compound Name | 4-hydroxy-5,7-dimethyl-4aH-quinolin-2-one |
|---|---|
| PubChem CID | 75837145 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 4-hydroxy-5,7-dimethyl-4aH-quinolin-2-one |
| SMILES | CC1=CC2=NC(=O)C=C(O)C2C(C)=C1 |
| InChI | InChI=1S/C11H11NO2/c1-6-3-7(2)11-8(4-6)12-10(14)5-9(11)13/h3-5,11,13H,1-2H3 |
| InChIKey | ABEZXMCQIMVLAR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |