C16H15FN3O5S- — CID 7584067
(2R)-2-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylsulfanylbutanoate (PubChem CID 7584067) has the molecular formula C16H15FN3O5S- and a molecular weight of 380.38 g/mol. Its IUPAC name is (2R)-2-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylsulfanylbutanoate.
| Compound Name | (2R)-2-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7584067 |
| Molecular Formula | C16H15FN3O5S- |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2R)-2-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](/N=C/C1C(=O)NC(=O)N(c2ccc(F)cc2)C1=O)C(=O)[O-] |
| InChI | InChI=1S/C16H16FN3O5S/c1-26-7-6-12(15(23)24)18-8-11-13(21)19-16(25)20(14(11)22)10-4-2-9(17)3-5-10/h2-5,8,11-12H,6-7H2,1H3,(H,23,24)(H,19,21,25)/p-1/b18-8+/t11?,12-/m1/s1 |
| InChIKey | SQQJHWLUWFGQPF-MACYWNEQSA-M |
| XLogP | -0.03 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|