About 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine
3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7584297) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 7584297 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCn1nnc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C8H12N6/c1-4-14-8-6(11-12-14)7(13(2)3)9-5-10-8/h5H,4H2,1-3H3 |
| InChIKey | AZDJFVYJBHDTRO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine (CID 7584297) is 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine is CCn1nnc2c(N(C)C)ncnc21.
What is the InChIKey of 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is AZDJFVYJBHDTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6/c1-4-14-8-6(11-12-14)7(13(2)3)9-5-10-8/h5H,4H2,1-3H3.
What are the key properties of 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine?
3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 192.23 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 7584297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).