C12H20N6 — CID 7584299
3-ethyl-N,N-dipropyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7584299) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-ethyl-N,N-dipropyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-ethyl-N,N-dipropyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 7584299 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-ethyl-N,N-dipropyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCN(CCC)c1ncnc2c1nnn2CC |
| InChI | InChI=1S/C12H20N6/c1-4-7-17(8-5-2)11-10-12(14-9-13-11)18(6-3)16-15-10/h9H,4-8H2,1-3H3 |
| InChIKey | NUFUCCIEXRWNIZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |