C14H24N3O3S+ — CID 7585639
2-[(5-ethoxycarbonyl-6-methyl-2-oxo-1H-pyrimidin-4-yl)sulfanyl]ethyl-diethylazanium (PubChem CID 7585639) has the molecular formula C14H24N3O3S+ and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(5-ethoxycarbonyl-6-methyl-2-oxo-1H-pyrimidin-4-yl)sulfanyl]ethyl-diethylazanium.
| Compound Name | 2-[(5-ethoxycarbonyl-6-methyl-2-oxo-1H-pyrimidin-4-yl)sulfanyl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7585639 |
| Molecular Formula | C14H24N3O3S+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[(5-ethoxycarbonyl-6-methyl-2-oxo-1H-pyrimidin-4-yl)sulfanyl]ethyl-diethylazanium |
| SMILES | CCOC(=O)c1c(SCC[NH+](CC)CC)nc(=O)[nH]c1C |
| InChI | InChI=1S/C14H23N3O3S/c1-5-17(6-2)8-9-21-12-11(13(18)20-7-3)10(4)15-14(19)16-12/h5-9H2,1-4H3,(H,15,16,19)/p+1 |
| InChIKey | DOPTZFLIHMCNPN-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |