C14H23N3O3S — CID 7585640
ethyl 4-[2-(diethylamino)ethylsulfanyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 7585640) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is ethyl 4-[2-(diethylamino)ethylsulfanyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-(diethylamino)ethylsulfanyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7585640 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 4-[2-(diethylamino)ethylsulfanyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(SCCN(CC)CC)nc(=O)[nH]c1C |
| InChI | InChI=1S/C14H23N3O3S/c1-5-17(6-2)8-9-21-12-11(13(18)20-7-3)10(4)15-14(19)16-12/h5-9H2,1-4H3,(H,15,16,19) |
| InChIKey | DOPTZFLIHMCNPN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |