C17H18FN7O3 — CID 7585872
2-[9-(4-fluorophenyl)-1-methyl-2,4-dioxo-7,8-dihydro-6H-purino[7,8-a]pyrimidin-3-yl]acetohydrazide (PubChem CID 7585872) has the molecular formula C17H18FN7O3 and a molecular weight of 387.38 g/mol. Its IUPAC name is 2-[9-(4-fluorophenyl)-1-methyl-2,4-dioxo-7,8-dihydro-6H-purino[7,8-a]pyrimidin-3-yl]acetohydrazide.
| Compound Name | 2-[9-(4-fluorophenyl)-1-methyl-2,4-dioxo-7,8-dihydro-6H-purino[7,8-a]pyrimidin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 7585872 |
| Molecular Formula | C17H18FN7O3 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[9-(4-fluorophenyl)-1-methyl-2,4-dioxo-7,8-dihydro-6H-purino[7,8-a]pyrimidin-3-yl]acetohydrazide |
| SMILES | Cn1c(=O)n(CC(=O)NN)c(=O)c2c1nc1n2CCCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN7O3/c1-22-14-13(15(27)25(17(22)28)9-12(26)21-19)24-8-2-7-23(16(24)20-14)11-5-3-10(18)4-6-11/h3-6H,2,7-9,19H2,1H3,(H,21,26) |
| InChIKey | PEASAYNLKUQTLP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|