C20H25N5O5 — CID 7586062
6-(2,5-dimethoxyphenyl)-2-(2-ethoxyethyl)-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 7586062) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-2-(2-ethoxyethyl)-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2,5-dimethoxyphenyl)-2-(2-ethoxyethyl)-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7586062 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-2-(2-ethoxyethyl)-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOCCn1c(=O)c2c(nc3n2CCN3c2cc(OC)ccc2OC)n(C)c1=O |
| InChI | InChI=1S/C20H25N5O5/c1-5-30-11-10-25-18(26)16-17(22(2)20(25)27)21-19-23(8-9-24(16)19)14-12-13(28-3)6-7-15(14)29-4/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | VWALTMMIRAGKLV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|