C20H21N3O3 — CID 7586388
N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-N'-(2-methylphenyl)oxamide (PubChem CID 7586388) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-N'-(2-methylphenyl)oxamide.
| Compound Name | N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 7586388 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-N'-(2-methylphenyl)oxamide |
| SMILES | CC(=O)N1CCCc2ccc(NC(=O)C(=O)Nc3ccccc3C)cc21 |
| InChI | InChI=1S/C20H21N3O3/c1-13-6-3-4-8-17(13)22-20(26)19(25)21-16-10-9-15-7-5-11-23(14(2)24)18(15)12-16/h3-4,6,8-10,12H,5,7,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | KDCSCGJKRZBAAY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|