C18H18N2O8 — CID 7587008
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2,5-dimethoxybenzoate (PubChem CID 7587008) has the molecular formula C18H18N2O8 and a molecular weight of 390.35 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2,5-dimethoxybenzoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7587008 |
| Molecular Formula | C18H18N2O8 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2OC)c1 |
| InChI | InChI=1S/C18H18N2O8/c1-25-12-5-7-15(26-2)13(9-12)18(22)28-10-17(21)19-14-6-4-11(20(23)24)8-16(14)27-3/h4-9H,10H2,1-3H3,(H,19,21) |
| InChIKey | TZVPGFYANQSJHF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|