About 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one
6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one (PubChem CID 7587276) has the molecular formula C18H12ClN3OS
and a molecular weight of 353.83 g/mol. Its IUPAC name is 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one |
| PubChem CID | 7587276 |
| Molecular Formula | C18H12ClN3OS |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one |
| SMILES | O=c1c2cc(Cl)ccc2ncn1Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H12ClN3OS/c19-13-6-7-16-15(8-13)18(23)22(11-20-16)9-14-10-24-17(21-14)12-4-2-1-3-5-12/h1-8,10-11H,9H2 |
| InChIKey | PCSSQANKKHIZRZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The IUPAC name of 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one (CID 7587276) is 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one.
What is the SMILES notation for 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The canonical SMILES for 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one is O=c1c2cc(Cl)ccc2ncn1Cc1csc(-c2ccccc2)n1.
What is the InChIKey of 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The InChIKey is PCSSQANKKHIZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN3OS/c19-13-6-7-16-15(8-13)18(23)22(11-20-16)9-14-10-24-17(21-14)12-4-2-1-3-5-12/h1-8,10-11H,9H2.
What are the key properties of 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one has a molecular weight of 353.83 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one is sourced from PubChem (CID 7587276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).