C25H30N2O4 — CID 7587597
ethyl (2S)-3-(1H-indol-3-yl)-2-[(4-pentoxybenzoyl)amino]propanoate (PubChem CID 7587597) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl (2S)-3-(1H-indol-3-yl)-2-[(4-pentoxybenzoyl)amino]propanoate.
| Compound Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[(4-pentoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7587597 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[(4-pentoxybenzoyl)amino]propanoate |
| SMILES | CCCCCOc1ccc(C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-3-5-8-15-31-20-13-11-18(12-14-20)24(28)27-23(25(29)30-4-2)16-19-17-26-22-10-7-6-9-21(19)22/h6-7,9-14,17,23,26H,3-5,8,15-16H2,1-2H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | JFMYOZXGRGXUMJ-QHCPKHFHSA-N |
| XLogP | 4.64 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|