C22H21N5O — CID 75890418
3-[2-(pyridin-3-ylmethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 75890418) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[2-(pyridin-3-ylmethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(pyridin-3-ylmethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 75890418 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-[2-(pyridin-3-ylmethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1OCc1cccnc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C22H21N5O/c23-14-19(22-26-25-21-10-2-1-5-12-27(21)22)13-18-8-3-4-9-20(18)28-16-17-7-6-11-24-15-17/h3-4,6-9,11,13,15H,1-2,5,10,12,16H2 |
| InChIKey | OKILLHFPERBUBD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|