C21H26FNO2 — CID 75893243
N-[(2-fluorophenyl)methyl]-N-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propanamide (PubChem CID 75893243) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 75893243 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propanamide |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)N(C)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C21H26FNO2/c1-14(2)18-11-10-15(3)12-20(18)25-16(4)21(24)23(5)13-17-8-6-7-9-19(17)22/h6-12,14,16H,13H2,1-5H3 |
| InChIKey | DNVITCAFDHAIKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |