C16H26N6O2 — CID 7589329
N-cyclopentyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 7589329) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-cyclopentyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-cyclopentyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7589329 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-cyclopentyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | C1CCC(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C16H26N6O2/c1-2-4-13(3-1)17-14-18-15(21-5-9-23-10-6-21)20-16(19-14)22-7-11-24-12-8-22/h13H,1-12H2,(H,17,18,19,20) |
| InChIKey | BIVVMJJBCPSCAK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |