C10H20N6O — CID 7589455
3-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol (PubChem CID 7589455) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 7589455 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol |
| SMILES | CCNc1nc(NCC)nc(NCCCO)n1 |
| InChI | InChI=1S/C10H20N6O/c1-3-11-8-14-9(12-4-2)16-10(15-8)13-6-5-7-17/h17H,3-7H2,1-2H3,(H3,11,12,13,14,15,16) |
| InChIKey | FQFLHAHBQRULFU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|