C10H15N7S — CID 7589456
4-N,6-N-diethyl-2-N-(1,3-thiazol-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 7589456) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-N,6-N-diethyl-2-N-(1,3-thiazol-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diethyl-2-N-(1,3-thiazol-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 7589456 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-N,6-N-diethyl-2-N-(1,3-thiazol-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(Nc2nccs2)n1 |
| InChI | InChI=1S/C10H15N7S/c1-3-11-7-14-8(12-4-2)16-9(15-7)17-10-13-5-6-18-10/h5-6H,3-4H2,1-2H3,(H3,11,12,13,14,15,16,17) |
| InChIKey | WDSSXAYVNDLVML-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |