About (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate
(4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate (PubChem CID 7589530) has the molecular formula C17H12BrClO4
and a molecular weight of 395.64 g/mol. Its IUPAC name is (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate.
Molecular Properties
| Compound Name | (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
| PubChem CID | 7589530 |
| Molecular Formula | C17H12BrClO4 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
| SMILES | Cc1cc(Br)cc(Cl)c1OC(=O)[C@@H]1Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C17H12BrClO4/c1-9-6-11(18)8-13(19)15(9)23-17(21)14-7-10-4-2-3-5-12(10)16(20)22-14/h2-6,8,14H,7H2,1H3/t14-/m0/s1 |
| InChIKey | MUZAQTZSAHBSNU-AWEZNQCLSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate?
The IUPAC name of (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate (CID 7589530) is (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate.
What is the SMILES notation for (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate?
The canonical SMILES for (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate is Cc1cc(Br)cc(Cl)c1OC(=O)[C@@H]1Cc2ccccc2C(=O)O1.
What is the InChIKey of (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate?
The InChIKey is MUZAQTZSAHBSNU-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H12BrClO4/c1-9-6-11(18)8-13(19)15(9)23-17(21)14-7-10-4-2-3-5-12(10)16(20)22-14/h2-6,8,14H,7H2,1H3/t14-/m0/s1.
What are the key properties of (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate?
(4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate has a molecular weight of 395.64 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-chloro-6-methylphenyl) (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate is sourced from PubChem (CID 7589530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).