About N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide
N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 758956) has the molecular formula C13H11N3O2S2
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| PubChem CID | 758956 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc3nsnc23)c1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-9-4-2-5-10(8-9)16-20(17,18)12-7-3-6-11-13(12)15-19-14-11/h2-8,16H,1H3 |
| InChIKey | JYSBKJZGDWIMKD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide?
The IUPAC name of N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide (CID 758956) is N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
What is the SMILES notation for N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide?
The canonical SMILES for N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide is Cc1cccc(NS(=O)(=O)c2cccc3nsnc23)c1.
What is the InChIKey of N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide?
The InChIKey is JYSBKJZGDWIMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S2/c1-9-4-2-5-10(8-9)16-20(17,18)12-7-3-6-11-13(12)15-19-14-11/h2-8,16H,1H3.
What are the key properties of N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide?
N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide has a molecular weight of 305.38 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide is sourced from PubChem (CID 758956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).