C15H13F2N3O5 — CID 7590806
(4S)-4-[2-(difluoromethoxy)-5-nitrophenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 7590806) has the molecular formula C15H13F2N3O5 and a molecular weight of 353.28 g/mol. Its IUPAC name is (4S)-4-[2-(difluoromethoxy)-5-nitrophenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | (4S)-4-[2-(difluoromethoxy)-5-nitrophenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 7590806 |
| Molecular Formula | C15H13F2N3O5 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (4S)-4-[2-(difluoromethoxy)-5-nitrophenyl]-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)[C@H](c2cc([N+](=O)[O-])ccc2OC(F)F)N1 |
| InChI | InChI=1S/C15H13F2N3O5/c16-14(17)25-11-5-4-7(20(23)24)6-8(11)13-12-9(18-15(22)19-13)2-1-3-10(12)21/h4-6,13-14H,1-3H2,(H2,18,19,22)/t13-/m0/s1 |
| InChIKey | RHSYZJWDVRFDHB-ZDUSSCGKSA-N |
| XLogP | 2.56 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|