About ethyl N-phenylcarbamate
ethyl N-phenylcarbamate (PubChem CID 7591) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | ethyl N-phenylcarbamate |
| PubChem CID | 7591 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | ethyl N-phenylcarbamate |
| SMILES | CCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| InChIKey | LBKPGNUOUPTQKA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-phenylcarbamate?
The IUPAC name of ethyl N-phenylcarbamate (CID 7591) is ethyl N-phenylcarbamate.
What is the SMILES notation for ethyl N-phenylcarbamate?
The canonical SMILES for ethyl N-phenylcarbamate is CCOC(=O)Nc1ccccc1.
What is the InChIKey of ethyl N-phenylcarbamate?
The InChIKey is LBKPGNUOUPTQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11).
What are the key properties of ethyl N-phenylcarbamate?
ethyl N-phenylcarbamate has a molecular weight of 165.19 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-phenylcarbamate is sourced from PubChem (CID 7591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).