C15H15N5O3S — CID 759197
3-tert-butyl-7-(3-nitrophenyl)-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one (PubChem CID 759197) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-tert-butyl-7-(3-nitrophenyl)-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one.
| Compound Name | 3-tert-butyl-7-(3-nitrophenyl)-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one |
|---|---|
| PubChem CID | 759197 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-tert-butyl-7-(3-nitrophenyl)-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-4-one |
| SMILES | CC(C)(C)c1nnc2n(c1=O)N=C(c1cccc([N+](=O)[O-])c1)CS2 |
| InChI | InChI=1S/C15H15N5O3S/c1-15(2,3)12-13(21)19-14(17-16-12)24-8-11(18-19)9-5-4-6-10(7-9)20(22)23/h4-7H,8H2,1-3H3 |
| InChIKey | KUDVIKFFAPJDLR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 103.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|