About 3-oxo-N-phenylbutanamide
3-oxo-N-phenylbutanamide (PubChem CID 7592) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-oxo-N-phenylbutanamide.
Molecular Properties
| Compound Name | 3-oxo-N-phenylbutanamide |
| PubChem CID | 7592 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,11,13) |
| InChIKey | DYRDKSSFIWVSNM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-N-phenylbutanamide?
The IUPAC name of 3-oxo-N-phenylbutanamide (CID 7592) is 3-oxo-N-phenylbutanamide.
What is the SMILES notation for 3-oxo-N-phenylbutanamide?
The canonical SMILES for 3-oxo-N-phenylbutanamide is CC(=O)CC(=O)Nc1ccccc1.
What is the InChIKey of 3-oxo-N-phenylbutanamide?
The InChIKey is DYRDKSSFIWVSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,11,13).
What are the key properties of 3-oxo-N-phenylbutanamide?
3-oxo-N-phenylbutanamide has a molecular weight of 177.20 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-N-phenylbutanamide is sourced from PubChem (CID 7592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).