About (4-bromophenyl) 3-phenylprop-2-enoate
(4-bromophenyl) 3-phenylprop-2-enoate (PubChem CID 759220) has the molecular formula C15H11BrO2
and a molecular weight of 303.16 g/mol. Its IUPAC name is (4-bromophenyl) 3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | (4-bromophenyl) 3-phenylprop-2-enoate |
| PubChem CID | 759220 |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | (4-bromophenyl) 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrO2/c16-13-7-9-14(10-8-13)18-15(17)11-6-12-4-2-1-3-5-12/h1-11H |
| InChIKey | FXZAPECDHLNXCB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) 3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) 3-phenylprop-2-enoate?
The IUPAC name of (4-bromophenyl) 3-phenylprop-2-enoate (CID 759220) is (4-bromophenyl) 3-phenylprop-2-enoate.
What is the SMILES notation for (4-bromophenyl) 3-phenylprop-2-enoate?
The canonical SMILES for (4-bromophenyl) 3-phenylprop-2-enoate is O=C(C=Cc1ccccc1)Oc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl) 3-phenylprop-2-enoate?
The InChIKey is FXZAPECDHLNXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO2/c16-13-7-9-14(10-8-13)18-15(17)11-6-12-4-2-1-3-5-12/h1-11H.
What are the key properties of (4-bromophenyl) 3-phenylprop-2-enoate?
(4-bromophenyl) 3-phenylprop-2-enoate has a molecular weight of 303.16 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) 3-phenylprop-2-enoate is sourced from PubChem (CID 759220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).