C14H17N3O4 — CID 7592436
(2S)-4-(2-cyanoanilino)-2-[[(2S)-2-hydroxypropyl]azaniumyl]-4-oxobutanoate (PubChem CID 7592436) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2S)-4-(2-cyanoanilino)-2-[[(2S)-2-hydroxypropyl]azaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(2-cyanoanilino)-2-[[(2S)-2-hydroxypropyl]azaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7592436 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-4-(2-cyanoanilino)-2-[[(2S)-2-hydroxypropyl]azaniumyl]-4-oxobutanoate |
| SMILES | C[C@H](O)C[NH2+][C@@H](CC(=O)Nc1ccccc1C#N)C(=O)[O-] |
| InChI | InChI=1S/C14H17N3O4/c1-9(18)8-16-12(14(20)21)6-13(19)17-11-5-3-2-4-10(11)7-15/h2-5,9,12,16,18H,6,8H2,1H3,(H,17,19)(H,20,21)/t9-,12-/m0/s1 |
| InChIKey | IGSBBNGIZGHCPG-CABZTGNLSA-N |
| XLogP | -2.05 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |