C26H26N5O+ — CID 7593425
N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]naphthalene-1-carboxamide (PubChem CID 7593425) has the molecular formula C26H26N5O+ and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 7593425 |
| Molecular Formula | C26H26N5O+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]naphthalene-1-carboxamide |
| SMILES | C[NH+]1CCN(c2ccc(-c3ccc(NC(=O)c4cccc5ccccc45)cc3)nn2)CC1 |
| InChI | InChI=1S/C26H25N5O/c1-30-15-17-31(18-16-30)25-14-13-24(28-29-25)20-9-11-21(12-10-20)27-26(32)23-8-4-6-19-5-2-3-7-22(19)23/h2-14H,15-18H2,1H3,(H,27,32)/p+1 |
| InChIKey | RGHRHAMTSFHIJV-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |