About 5-nitro-2-phenyl-1,3-benzoxazole
5-nitro-2-phenyl-1,3-benzoxazole (PubChem CID 759401) has the molecular formula C13H8N2O3
and a molecular weight of 240.22 g/mol. Its IUPAC name is 5-nitro-2-phenyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-nitro-2-phenyl-1,3-benzoxazole |
| PubChem CID | 759401 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-nitro-2-phenyl-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C13H8N2O3/c16-15(17)10-6-7-12-11(8-10)14-13(18-12)9-4-2-1-3-5-9/h1-8H |
| InChIKey | PBRISAFILDFQFS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-phenyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-phenyl-1,3-benzoxazole?
The IUPAC name of 5-nitro-2-phenyl-1,3-benzoxazole (CID 759401) is 5-nitro-2-phenyl-1,3-benzoxazole.
What is the SMILES notation for 5-nitro-2-phenyl-1,3-benzoxazole?
The canonical SMILES for 5-nitro-2-phenyl-1,3-benzoxazole is O=[N+]([O-])c1ccc2oc(-c3ccccc3)nc2c1.
What is the InChIKey of 5-nitro-2-phenyl-1,3-benzoxazole?
The InChIKey is PBRISAFILDFQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O3/c16-15(17)10-6-7-12-11(8-10)14-13(18-12)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-nitro-2-phenyl-1,3-benzoxazole?
5-nitro-2-phenyl-1,3-benzoxazole has a molecular weight of 240.22 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-phenyl-1,3-benzoxazole is sourced from PubChem (CID 759401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).