C18H9N3O3 — CID 759425
15-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-11-one (PubChem CID 759425) has the molecular formula C18H9N3O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 15-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-11-one.
| Compound Name | 15-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-11-one |
|---|---|
| PubChem CID | 759425 |
| Molecular Formula | C18H9N3O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 15-nitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-11-one |
| SMILES | O=c1c2ccc([N+](=O)[O-])c3cccc(c32)c2nc3ccccc3n12 |
| InChI | InChI=1S/C18H9N3O3/c22-18-12-8-9-14(21(23)24)10-4-3-5-11(16(10)12)17-19-13-6-1-2-7-15(13)20(17)18/h1-9H |
| InChIKey | JLAHLIKOBNNHKO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|