C17H16ClN3O3S — CID 7595155
[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-amino-4-chlorobenzoate (PubChem CID 7595155) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7595155 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-amino-4-chlorobenzoate |
| SMILES | Cc1sc2nc([C@@H](C)OC(=O)c3ccc(Cl)cc3N)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H16ClN3O3S/c1-7-9(3)25-16-13(7)15(22)20-14(21-16)8(2)24-17(23)11-5-4-10(18)6-12(11)19/h4-6,8H,19H2,1-3H3,(H,20,21,22)/t8-/m1/s1 |
| InChIKey | RZDHJAVPWRLNFU-MRVPVSSYSA-N |
| XLogP | 3.76 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|