About 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide
5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide (PubChem CID 759525) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide |
| PubChem CID | 759525 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H21N3O/c1-14(2)21-20(24)18-15(3)23(17-12-8-5-9-13-17)22-19(18)16-10-6-4-7-11-16/h4-14H,1-3H3,(H,21,24) |
| InChIKey | HRTVJMDIVASELO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide?
The IUPAC name of 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide (CID 759525) is 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide.
What is the SMILES notation for 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide?
The canonical SMILES for 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide is Cc1c(C(=O)NC(C)C)c(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide?
The InChIKey is HRTVJMDIVASELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O/c1-14(2)21-20(24)18-15(3)23(17-12-8-5-9-13-17)22-19(18)16-10-6-4-7-11-16/h4-14H,1-3H3,(H,21,24).
What are the key properties of 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide?
5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide has a molecular weight of 319.41 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3-diphenyl-N-propan-2-ylpyrazole-4-carboxamide is sourced from PubChem (CID 759525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).