C12H23NO4 — CID 75952896
tert-butyl 2-(1,2-dihydroxyethyl)piperidine-1-carboxylate (PubChem CID 75952896) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is tert-butyl 2-(1,2-dihydroxyethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1,2-dihydroxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75952896 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | tert-butyl 2-(1,2-dihydroxyethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(O)CO |
| InChI | InChI=1S/C12H23NO4/c1-12(2,3)17-11(16)13-7-5-4-6-9(13)10(15)8-14/h9-10,14-15H,4-8H2,1-3H3 |
| InChIKey | JBQYOMWZWWNBBG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |