C14H24O4 — CID 75953516
9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one (PubChem CID 75953516) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one.
| Compound Name | 9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one |
|---|---|
| PubChem CID | 75953516 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one |
| SMILES | CC1CCCCC2C(O)CCC(O)C2CC(=O)O1 |
| InChI | InChI=1S/C14H24O4/c1-9-4-2-3-5-10-11(8-14(17)18-9)13(16)7-6-12(10)15/h9-13,15-16H,2-8H2,1H3 |
| InChIKey | VDMSRLJJKGITNQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |